C18H24N2O4 — CID 136912631
(1S,3S,4S)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 136912631) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,3S,4S)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,3S,4S)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 136912631 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (1S,3S,4S)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@]2(C(=O)N/N=C\c3ccc(O)cc3O)CC[C@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/C18H24N2O4/c1-16(2)17(3)6-7-18(16,9-14(17)23)15(24)20-19-10-11-4-5-12(21)8-13(11)22/h4-5,8,10,14,21-23H,6-7,9H2,1-3H3,(H,20,24)/b19-10-/t14-,17+,18+/m0/s1 |
| InChIKey | SLJZDUYMZZFUJQ-VZMYBVHRSA-N |
| XLogP | 2.13 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|