C17H25NO2S — CID 98364272
N-(oxan-4-yl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]acetamide (PubChem CID 98364272) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-(oxan-4-yl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-(oxan-4-yl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 98364272 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-(oxan-4-yl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cc(C)c(CSCC(=O)NC2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C17H25NO2S/c1-12-8-13(2)16(14(3)9-12)10-21-11-17(19)18-15-4-6-20-7-5-15/h8-9,15H,4-7,10-11H2,1-3H3,(H,18,19) |
| InChIKey | UVDCKOJXMFWBNI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |