C26H28N4O7 — CID 98364559
(2'R,4'R,4'aS,5S)-1-[2-(4-methoxyphenyl)ethyl]-2',4'-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 98364559) has the molecular formula C26H28N4O7 and a molecular weight of 508.53 g/mol. Its IUPAC name is (2'R,4'R,4'aS,5S)-1-[2-(4-methoxyphenyl)ethyl]-2',4'-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (2'R,4'R,4'aS,5S)-1-[2-(4-methoxyphenyl)ethyl]-2',4'-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 98364559 |
| Molecular Formula | C26H28N4O7 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (2'R,4'R,4'aS,5S)-1-[2-(4-methoxyphenyl)ethyl]-2',4'-dimethyl-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccc(CCN2C(=O)NC(=O)[C@@]3(Cc4cc([N+](=O)[O-])ccc4N4C[C@@H](C)O[C@H](C)[C@@H]43)C2=O)cc1 |
| InChI | InChI=1S/C26H28N4O7/c1-15-14-29-21-9-6-19(30(34)35)12-18(21)13-26(22(29)16(2)37-15)23(31)27-25(33)28(24(26)32)11-10-17-4-7-20(36-3)8-5-17/h4-9,12,15-16,22H,10-11,13-14H2,1-3H3,(H,27,31,33)/t15-,16-,22-,26+/m1/s1 |
| InChIKey | AEPWCAQCZHVLSJ-HJFHUXPASA-N |
| XLogP | 2.45 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|