C27H25ClN4O6 — CID 98377322
ethyl 6-[2-(4-chlorophenoxy)acetyl]imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 98377322) has the molecular formula C27H25ClN4O6 and a molecular weight of 536.97 g/mol. Its IUPAC name is ethyl 6-[2-(4-chlorophenoxy)acetyl]imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-[2-(4-chlorophenoxy)acetyl]imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 98377322 |
| Molecular Formula | C27H25ClN4O6 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | ethyl 6-[2-(4-chlorophenoxy)acetyl]imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)/c1=N/C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H25ClN4O6/c1-2-36-27(35)21-14-20-24(29-22-7-3-4-12-31(22)26(20)34)32(15-19-6-5-13-37-19)25(21)30-23(33)16-38-18-10-8-17(28)9-11-18/h3-4,7-12,14,19H,2,5-6,13,15-16H2,1H3/b30-25+/t19-/m1/s1 |
| InChIKey | GAYHLPXBMXOIPP-XXBFNOQOSA-N |
| XLogP | 3.16 |
| TPSA | 113.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|