C26H29N3O5S — CID 98377819
N-[4-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 98377819) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[4-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[4-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 98377819 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[4-[[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(NC(=O)CCN2C(=O)c3ccccc3C2=O)cc1)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C26H29N3O5S/c1-16(23-15-17-6-7-18(23)14-17)28-35(33,34)20-10-8-19(9-11-20)27-24(30)12-13-29-25(31)21-4-2-3-5-22(21)26(29)32/h2-5,8-11,16-18,23,28H,6-7,12-15H2,1H3,(H,27,30)/t16-,17+,18+,23-/m0/s1 |
| InChIKey | GVAYUJORXKZPMY-JFNLIGNMSA-N |
| XLogP | 3.41 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|