C26H31BrN2O4 — CID 98378198
(4E,5S)-5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 98378198) has the molecular formula C26H31BrN2O4 and a molecular weight of 515.45 g/mol. Its IUPAC name is (4E,5S)-5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98378198 |
| Molecular Formula | C26H31BrN2O4 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | (4E,5S)-5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(CCCN(C)C)[C@H]2c2cccc(Br)c2)ccc1OC(C)C |
| InChI | InChI=1S/C26H31BrN2O4/c1-16(2)33-21-11-10-19(14-17(21)3)24(30)22-23(18-8-6-9-20(27)15-18)29(26(32)25(22)31)13-7-12-28(4)5/h6,8-11,14-16,23,30H,7,12-13H2,1-5H3/b24-22+/t23-/m0/s1 |
| InChIKey | XHJSQFBWURSUCN-AYWGPLOBSA-N |
| XLogP | 4.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|