C22H16BrClN2O6 — CID 98382007
(4E,5R)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione (PubChem CID 98382007) has the molecular formula C22H16BrClN2O6 and a molecular weight of 519.74 g/mol. Its IUPAC name is (4E,5R)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98382007 |
| Molecular Formula | C22H16BrClN2O6 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | (4E,5R)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@@H]2/C(=C(\O)c3ccc(Cl)cc3)C(=O)C(=O)N2c2cc(C)on2)cc(Br)c1O |
| InChI | InChI=1S/C22H16BrClN2O6/c1-10-7-16(25-32-10)26-18(12-8-14(23)20(28)15(9-12)31-2)17(21(29)22(26)30)19(27)11-3-5-13(24)6-4-11/h3-9,18,27-28H,1-2H3/b19-17+/t18-/m1/s1 |
| InChIKey | AMZJPTMGFPIANP-SELCWUDQSA-N |
| XLogP | 4.74 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|