C23H19BrN2O6 — CID 3795220
4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione (PubChem CID 3795220) has the molecular formula C23H19BrN2O6 and a molecular weight of 499.32 g/mol. Its IUPAC name is 4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3795220 |
| Molecular Formula | C23H19BrN2O6 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(=C(O)c3ccc(Br)cc3)C(=O)C(=O)N2c2cc(C)on2)cc1OC |
| InChI | InChI=1S/C23H19BrN2O6/c1-12-10-18(25-32-12)26-20(14-6-9-16(30-2)17(11-14)31-3)19(22(28)23(26)29)21(27)13-4-7-15(24)8-5-13/h4-11,20,27H,1-3H3 |
| InChIKey | CGBWVACPUMNQDT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|