C26H26N2O7 — CID 3714712
5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione (PubChem CID 3714712) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3714712 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(=C(O)c3ccc(OC(C)C)cc3)C(=O)C(=O)N2c2cc(C)on2)cc1OC |
| InChI | InChI=1S/C26H26N2O7/c1-14(2)34-18-9-6-16(7-10-18)24(29)22-23(17-8-11-19(32-4)20(13-17)33-5)28(26(31)25(22)30)21-12-15(3)35-27-21/h6-14,23,29H,1-5H3 |
| InChIKey | WSZKKMYQDRATSY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|