C24H21ClN2O7 — CID 3341028
4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione (PubChem CID 3341028) has the molecular formula C24H21ClN2O7 and a molecular weight of 484.89 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3341028 |
| Molecular Formula | C24H21ClN2O7 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(c3cc(C)on3)C2c2ccc(OC)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C24H21ClN2O7/c1-12-9-19(26-34-12)27-21(13-5-8-17(32-3)18(11-13)33-4)20(23(29)24(27)30)22(28)14-6-7-16(31-2)15(25)10-14/h5-11,21,28H,1-4H3 |
| InChIKey | DGAIYVSCCUTSHO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|