C22H16BrClN2O5 — CID 40835962
(5R)-5-(3-bromophenyl)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione (PubChem CID 40835962) has the molecular formula C22H16BrClN2O5 and a molecular weight of 503.74 g/mol. Its IUPAC name is (5R)-5-(3-bromophenyl)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(3-bromophenyl)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40835962 |
| Molecular Formula | C22H16BrClN2O5 |
| Molecular Weight | 503.74 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | (5R)-5-(3-bromophenyl)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(c3cc(C)on3)[C@@H]2c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C22H16BrClN2O5/c1-11-8-17(25-31-11)26-19(12-4-3-5-14(23)9-12)18(21(28)22(26)29)20(27)13-6-7-16(30-2)15(24)10-13/h3-10,19,27H,1-2H3/t19-/m1/s1 |
| InChIKey | OKQKFKUAPHXZFY-LJQANCHMSA-N |
| XLogP | 5.03 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|