C29H31N3O6 — CID 98382611
(4E,5R)-5-(4-ethoxy-3-methoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 98382611) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is (4E,5R)-5-(4-ethoxy-3-methoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(4-ethoxy-3-methoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98382611 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (4E,5R)-5-(4-ethoxy-3-methoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CCCn2ccnc2)cc1OC |
| InChI | InChI=1S/C29H31N3O6/c1-4-37-23-9-6-19(16-24(23)36-3)26-25(27(33)20-7-8-22-21(15-20)14-18(2)38-22)28(34)29(35)32(26)12-5-11-31-13-10-30-17-31/h6-10,13,15-18,26,33H,4-5,11-12,14H2,1-3H3/b27-25+/t18-,26+/m0/s1 |
| InChIKey | CGULVCMRMYFMFS-IOUQRVAPSA-N |
| XLogP | 4.13 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|