C21H23N3O3S2 — CID 98383871
ethyl (2R)-4-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate (PubChem CID 98383871) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is ethyl (2R)-4-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate.
| Compound Name | ethyl (2R)-4-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 98383871 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | ethyl (2R)-4-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](C(=O)CSc1nccn1-c1cccc(C)c1C)c1nc(C)cs1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-5-27-20(26)18(19-23-14(3)11-28-19)17(25)12-29-21-22-9-10-24(21)16-8-6-7-13(2)15(16)4/h6-11,18H,5,12H2,1-4H3/t18-/m0/s1 |
| InChIKey | RIESQFHQEOCAIS-SFHVURJKSA-N |
| XLogP | 4.26 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|