C21H22N4O3S2 — CID 42950971
ethyl 4-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate (PubChem CID 42950971) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is ethyl 4-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 42950971 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | ethyl 4-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(=O)CSc1nnc(C2CC2)n1-c1ccccc1)c1nc(C)cs1 |
| InChI | InChI=1S/C21H22N4O3S2/c1-3-28-20(27)17(19-22-13(2)11-29-19)16(26)12-30-21-24-23-18(14-9-10-14)25(21)15-7-5-4-6-8-15/h4-8,11,14,17H,3,9-10,12H2,1-2H3 |
| InChIKey | YMHBIBKCLVKNCL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|