C19H16F3N3O3S2 — CID 42950977
ethyl 2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-4-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylbutanoate (PubChem CID 42950977) has the molecular formula C19H16F3N3O3S2 and a molecular weight of 455.48 g/mol. Its IUPAC name is ethyl 2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-4-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylbutanoate.
| Compound Name | ethyl 2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-4-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 42950977 |
| Molecular Formula | C19H16F3N3O3S2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | ethyl 2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-4-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylbutanoate |
| SMILES | CCOC(=O)C(C(=O)CSc1nc(C(F)(F)F)nc2ccccc12)c1nc(C)cs1 |
| InChI | InChI=1S/C19H16F3N3O3S2/c1-3-28-17(27)14(16-23-10(2)8-29-16)13(26)9-30-15-11-6-4-5-7-12(11)24-18(25-15)19(20,21)22/h4-8,14H,3,9H2,1-2H3 |
| InChIKey | YRPYLGSDDKULAM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|