C15H15NO3S — CID 8024886
ethyl (2S)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-3-phenylpropanoate (PubChem CID 8024886) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is ethyl (2S)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 8024886 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | ethyl (2S)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](C(=O)c1ccccc1)c1nc(C)cs1 |
| InChI | InChI=1S/C15H15NO3S/c1-3-19-15(18)12(14-16-10(2)9-20-14)13(17)11-7-5-4-6-8-11/h4-9,12H,3H2,1-2H3/t12-/m1/s1 |
| InChIKey | SSJFFLXIDWJZGM-GFCCVEGCSA-N |
| XLogP | 2.98 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|