C20H21N3O4S — CID 51966333
methyl (2S)-3-(3-butyl-4-oxophthalazin-1-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanoate (PubChem CID 51966333) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is methyl (2S)-3-(3-butyl-4-oxophthalazin-1-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanoate.
| Compound Name | methyl (2S)-3-(3-butyl-4-oxophthalazin-1-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 51966333 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | methyl (2S)-3-(3-butyl-4-oxophthalazin-1-yl)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxopropanoate |
| SMILES | CCCCn1nc(C(=O)[C@@H](C(=O)OC)c2nc(C)cs2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H21N3O4S/c1-4-5-10-23-19(25)14-9-7-6-8-13(14)16(22-23)17(24)15(20(26)27-3)18-21-12(2)11-28-18/h6-9,11,15H,4-5,10H2,1-3H3/t15-/m1/s1 |
| InChIKey | YUWOAHNRTVFXPY-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|