C21H22ClN3O4 — CID 98400376
2-[[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-methylamino]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 98400376) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-methylamino]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-methylamino]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98400376 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-methylamino]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)[C@@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H22ClN3O4/c1-24(13-19(26)23-16-10-15(22)8-9-18(16)29-2)17-11-20(27)25(21(17)28)12-14-6-4-3-5-7-14/h3-10,17H,11-13H2,1-2H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | WBTHELOPGGTVFK-QGZVFWFLSA-N |
| XLogP | 2.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|