C25H30ClN3O5S — CID 98405740
N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(N-(4-chloro-3-nitrophenyl)sulfonyl-2,4-dimethylanilino)acetamide (PubChem CID 98405740) has the molecular formula C25H30ClN3O5S and a molecular weight of 520.05 g/mol. Its IUPAC name is N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(N-(4-chloro-3-nitrophenyl)sulfonyl-2,4-dimethylanilino)acetamide.
| Compound Name | N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(N-(4-chloro-3-nitrophenyl)sulfonyl-2,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 98405740 |
| Molecular Formula | C25H30ClN3O5S |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(N-(4-chloro-3-nitrophenyl)sulfonyl-2,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(N(CC(=O)N[C@H](C)[C@@H]2C[C@@H]3CC[C@@H]2C3)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C25H30ClN3O5S/c1-15-4-9-23(16(2)10-15)28(35(33,34)20-7-8-22(26)24(13-20)29(31)32)14-25(30)27-17(3)21-12-18-5-6-19(21)11-18/h4,7-10,13,17-19,21H,5-6,11-12,14H2,1-3H3,(H,27,30)/t17-,18-,19-,21+/m1/s1 |
| InChIKey | KWGSPEIZXIERNL-XCJLJZCSSA-N |
| XLogP | 5.00 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|