C19H22ClF3N4OS — CID 98406196
(2R)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide (PubChem CID 98406196) has the molecular formula C19H22ClF3N4OS and a molecular weight of 446.93 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 98406196 |
| Molecular Formula | C19H22ClF3N4OS |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (2R)-N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide |
| SMILES | C[C@H](NC(=O)[C@@H](C)Sc1nnc2c(Cl)cc(C(F)(F)F)cn12)[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C19H22ClF3N4OS/c1-9(14-6-11-3-4-12(14)5-11)24-17(28)10(2)29-18-26-25-16-15(20)7-13(8-27(16)18)19(21,22)23/h7-12,14H,3-6H2,1-2H3,(H,24,28)/t9-,10+,11+,12+,14+/m0/s1 |
| InChIKey | WSSPXDSLJIVZFS-WRYZSIRCSA-N |
| XLogP | 4.82 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |