C32H36N2O6 — CID 98409088
[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate (PubChem CID 98409088) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 98409088 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (3Z)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydrocyclopenta[b]quinoline-9-carboxylate |
| SMILES | COc1cc(/C=C2/CCc3c2nc2ccccc2c3C(=O)OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc(OC)c1OC |
| InChI | InChI=1S/C32H36N2O6/c1-19-9-8-10-20(2)34(19)28(35)18-40-32(36)29-23-11-6-7-12-25(23)33-30-22(13-14-24(29)30)15-21-16-26(37-3)31(39-5)27(17-21)38-4/h6-7,11-12,15-17,19-20H,8-10,13-14,18H2,1-5H3/b22-15-/t19-,20+ |
| InChIKey | REYZZCDPIXPJJQ-MTLPOGOCSA-N |
| XLogP | 5.69 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |