C31H36N2O9 — CID 98411516
4-O-[2-[1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 98411516) has the molecular formula C31H36N2O9 and a molecular weight of 580.63 g/mol. Its IUPAC name is 4-O-[2-[1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-[1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 98411516 |
| Molecular Formula | C31H36N2O9 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 4-O-[2-[1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCC(=O)c1cc(C)n(C[C@H]2COc3ccccc3O2)c1C |
| InChI | InChI=1S/C31H36N2O9/c1-7-38-29(35)26-18(4)32-19(5)27(30(36)39-8-2)28(26)31(37)41-16-23(34)22-13-17(3)33(20(22)6)14-21-15-40-24-11-9-10-12-25(24)42-21/h9-13,21,28,32H,7-8,14-16H2,1-6H3/t21-/m0/s1 |
| InChIKey | MELDPQVPZFLGID-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|