C22H16N4O — CID 98413094
N-(3-ethynylphenyl)-N-methyl-7-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 98413094) has the molecular formula C22H16N4O and a molecular weight of 352.40 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-N-methyl-7-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-N-methyl-7-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 98413094 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-(3-ethynylphenyl)-N-methyl-7-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C#Cc1cccc(N(C)C(=O)c2cnn3c(-c4ccccc4)ccnc23)c1 |
| InChI | InChI=1S/C22H16N4O/c1-3-16-8-7-11-18(14-16)25(2)22(27)19-15-24-26-20(12-13-23-21(19)26)17-9-5-4-6-10-17/h1,4-15H,2H3 |
| InChIKey | BWISUATXUDJMKY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|