C19H21N3O3 — CID 98417656
2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methyl-1H-indol-5-yl)acetamide (PubChem CID 98417656) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methyl-1H-indol-5-yl)acetamide.
| Compound Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methyl-1H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 98417656 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methyl-1H-indol-5-yl)acetamide |
| SMILES | Cc1cc2cc(NC(=O)CN3C(=O)[C@@H]4CCCC[C@H]4C3=O)ccc2[nH]1 |
| InChI | InChI=1S/C19H21N3O3/c1-11-8-12-9-13(6-7-16(12)20-11)21-17(23)10-22-18(24)14-4-2-3-5-15(14)19(22)25/h6-9,14-15,20H,2-5,10H2,1H3,(H,21,23)/t14-,15-/m1/s1 |
| InChIKey | LCNVQHHTYOIFDZ-HUUCEWRRSA-N |
| XLogP | 2.59 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|