C22H19N3O4 — CID 98423033
2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(2-phenoxy-3-pyridinyl)acetamide (PubChem CID 98423033) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(2-phenoxy-3-pyridinyl)acetamide.
| Compound Name | 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(2-phenoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 98423033 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(2-phenoxy-3-pyridinyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2C1)Nc1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C22H19N3O4/c26-17(12-25-21(27)18-13-8-9-14(11-13)19(18)22(25)28)24-16-7-4-10-23-20(16)29-15-5-2-1-3-6-15/h1-10,13-14,18-19H,11-12H2,(H,24,26)/t13-,14-,18-,19-/m0/s1 |
| InChIKey | OEBNDCLHEIACML-LSOMNZGLSA-N |
| XLogP | 2.62 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|