C18H17ClN2O2 — CID 98445526
(3S,4S)-1-(5-chloro-2-pyridinyl)-3-methyl-4-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 98445526) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is (3S,4S)-1-(5-chloro-2-pyridinyl)-3-methyl-4-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-1-(5-chloro-2-pyridinyl)-3-methyl-4-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98445526 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (3S,4S)-1-(5-chloro-2-pyridinyl)-3-methyl-4-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(C[C@@H]2C(=O)N(c3ccc(Cl)cn3)C(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C18H17ClN2O2/c1-11-3-5-13(6-4-11)9-15-12(2)17(22)21(18(15)23)16-8-7-14(19)10-20-16/h3-8,10,12,15H,9H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | RLBZLIVQMWFZSV-WFASDCNBSA-N |
| XLogP | 3.41 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|