C20H18F3NO2 — CID 1108196
(3S,4S)-3-methyl-4-[(4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 1108196) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is (3S,4S)-3-methyl-4-[(4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-3-methyl-4-[(4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1108196 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (3S,4S)-3-methyl-4-[(4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(C[C@@H]2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C20H18F3NO2/c1-12-6-8-14(9-7-12)10-17-13(2)18(25)24(19(17)26)16-5-3-4-15(11-16)20(21,22)23/h3-9,11,13,17H,10H2,1-2H3/t13-,17-/m0/s1 |
| InChIKey | LIPCTGGFOGLSIF-GUYCJALGSA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|