C12H18N2O2S2 — CID 98446682
(3aR,6aS)-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione (PubChem CID 98446682) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (3aR,6aS)-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione.
| Compound Name | (3aR,6aS)-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 98446682 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (3aR,6aS)-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-2-thione |
| SMILES | O=S1(=O)C[C@H]2NC(=S)N([C@@H]3C[C@H]4CC[C@H]3C4)[C@H]2C1 |
| InChI | InChI=1S/C12H18N2O2S2/c15-18(16)5-9-11(6-18)14(12(17)13-9)10-4-7-1-2-8(10)3-7/h7-11H,1-6H2,(H,13,17)/t7-,8-,9+,10+,11-/m0/s1 |
| InChIKey | KJDKRDSDHXICOQ-DAWVFNFOSA-N |
| XLogP | 0.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|