C19H15FN2O2 — CID 98448720
(2R)-2-cyano-3-(2,3-dihydro-1H-inden-5-yl)-N-(4-fluorophenyl)-3-oxopropanamide (PubChem CID 98448720) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is (2R)-2-cyano-3-(2,3-dihydro-1H-inden-5-yl)-N-(4-fluorophenyl)-3-oxopropanamide.
| Compound Name | (2R)-2-cyano-3-(2,3-dihydro-1H-inden-5-yl)-N-(4-fluorophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 98448720 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (2R)-2-cyano-3-(2,3-dihydro-1H-inden-5-yl)-N-(4-fluorophenyl)-3-oxopropanamide |
| SMILES | N#C[C@@H](C(=O)Nc1ccc(F)cc1)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H15FN2O2/c20-15-6-8-16(9-7-15)22-19(24)17(11-21)18(23)14-5-4-12-2-1-3-13(12)10-14/h4-10,17H,1-3H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | WHQTUUOMFVDTNQ-QGZVFWFLSA-N |
| XLogP | 3.28 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|