C18H16N6O2 — CID 98449492
(4R)-4-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)-5-methyl-2-phenyl-4H-pyrazol-3-one (PubChem CID 98449492) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is (4R)-4-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)-5-methyl-2-phenyl-4H-pyrazol-3-one.
| Compound Name | (4R)-4-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)-5-methyl-2-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 98449492 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (4R)-4-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)-5-methyl-2-phenyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@H]1C(=O)c1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C18H16N6O2/c1-10-9-11(2)23-18(19-10)20-16(22-23)15(25)14-12(3)21-24(17(14)26)13-7-5-4-6-8-13/h4-9,14H,1-3H3/t14-/m1/s1 |
| InChIKey | YROSOFPUEADKOQ-CQSZACIVSA-N |
| XLogP | 1.96 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|