C16H16N2O6 — CID 98449523
5-[3-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 98449523) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 5-[3-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[3-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 98449523 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 5-[3-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(=O)c2cccc(OC[C@@H]3CCCO3)c2)C(=O)N1 |
| InChI | InChI=1S/C16H16N2O6/c19-13(12-14(20)17-16(22)18-15(12)21)9-3-1-4-10(7-9)24-8-11-5-2-6-23-11/h1,3-4,7,11-12H,2,5-6,8H2,(H2,17,18,20,21,22)/t11-/m0/s1 |
| InChIKey | IYTNTQVSBIUEOC-NSHDSACASA-N |
| XLogP | 0.41 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|