C18H17N3O2 — CID 98452653
(3aR,7aR)-2-[3-(pyrazol-1-ylmethyl)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 98452653) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3aR,7aR)-2-[3-(pyrazol-1-ylmethyl)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[3-(pyrazol-1-ylmethyl)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98452653 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (3aR,7aR)-2-[3-(pyrazol-1-ylmethyl)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1c1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C18H17N3O2/c22-17-15-7-1-2-8-16(15)18(23)21(17)14-6-3-5-13(11-14)12-20-10-4-9-19-20/h1-6,9-11,15-16H,7-8,12H2/t15-,16-/m1/s1 |
| InChIKey | XXHYBVJGODYPRP-HZPDHXFCSA-N |
| XLogP | 2.39 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|