C28H20Br2N2O4 — CID 98456841
(10R,11S,15S,16S)-16-(3-bromo-4-methoxybenzoyl)-13-(4-bromophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 98456841) has the molecular formula C28H20Br2N2O4 and a molecular weight of 608.29 g/mol. Its IUPAC name is (10R,11S,15S,16S)-16-(3-bromo-4-methoxybenzoyl)-13-(4-bromophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11S,15S,16S)-16-(3-bromo-4-methoxybenzoyl)-13-(4-bromophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 98456841 |
| Molecular Formula | C28H20Br2N2O4 |
| Molecular Weight | 608.29 g/mol |
| Exact Mass | 605.98 |
| IUPAC Name | (10R,11S,15S,16S)-16-(3-bromo-4-methoxybenzoyl)-13-(4-bromophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H]3C(=O)N(c4ccc(Br)cc4)C(=O)[C@@H]3[C@H]3C=Cc4ccccc4N32)cc1Br |
| InChI | InChI=1S/C28H20Br2N2O4/c1-36-22-13-7-16(14-19(22)30)26(33)25-24-23(21-12-6-15-4-2-3-5-20(15)32(21)25)27(34)31(28(24)35)18-10-8-17(29)9-11-18/h2-14,21,23-25H,1H3/t21-,23-,24+,25+/m1/s1 |
| InChIKey | WBDPCILFGICCEC-VGCGRUFVSA-N |
| XLogP | 5.49 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|