C28H20BrFN2O4 — CID 3294031
16-(3-bromo-4-methoxybenzoyl)-13-(3-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 3294031) has the molecular formula C28H20BrFN2O4 and a molecular weight of 547.38 g/mol. Its IUPAC name is 16-(3-bromo-4-methoxybenzoyl)-13-(3-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | 16-(3-bromo-4-methoxybenzoyl)-13-(3-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 3294031 |
| Molecular Formula | C28H20BrFN2O4 |
| Molecular Weight | 547.38 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 16-(3-bromo-4-methoxybenzoyl)-13-(3-fluorophenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | COc1ccc(C(=O)C2C3C(=O)N(c4cccc(F)c4)C(=O)C3C3C=Cc4ccccc4N32)cc1Br |
| InChI | InChI=1S/C28H20BrFN2O4/c1-36-22-12-10-16(13-19(22)29)26(33)25-24-23(21-11-9-15-5-2-3-8-20(15)32(21)25)27(34)31(28(24)35)18-7-4-6-17(30)14-18/h2-14,21,23-25H,1H3 |
| InChIKey | XRICBSHPLVJRLD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|