C14H27NO4 — CID 98461368
methyl N-[(2S,4R)-4-nonyl-1,3-dioxolan-2-yl]carbamate (PubChem CID 98461368) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is methyl N-[(2S,4R)-4-nonyl-1,3-dioxolan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,4R)-4-nonyl-1,3-dioxolan-2-yl]carbamate |
|---|---|
| PubChem CID | 98461368 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | methyl N-[(2S,4R)-4-nonyl-1,3-dioxolan-2-yl]carbamate |
| SMILES | CCCCCCCCC[C@@H]1CO[C@H](NC(=O)OC)O1 |
| InChI | InChI=1S/C14H27NO4/c1-3-4-5-6-7-8-9-10-12-11-18-14(19-12)15-13(16)17-2/h12,14H,3-11H2,1-2H3,(H,15,16)/t12-,14+/m1/s1 |
| InChIKey | SXUFKOKRMISASY-OCCSQVGLSA-N |
| XLogP | 3.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|