C27H37N3O4S — CID 98463412
6-(azepan-1-ylsulfonyl)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 98463412) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | 6-(azepan-1-ylsulfonyl)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 98463412 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)c(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc21 |
| InChI | InChI=1S/C27H37N3O4S/c1-4-14-29-18-23(27(32)28-24-11-9-10-19(2)20(24)3)26(31)22-17-21(12-13-25(22)29)35(33,34)30-15-7-5-6-8-16-30/h4,12-13,17-20,24H,1,5-11,14-16H2,2-3H3,(H,28,32)/t19-,20+,24-/m1/s1 |
| InChIKey | IWDODUKFAARXQC-JXALWOEJSA-N |
| XLogP | 4.31 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|