C28H39N3O4S2 — CID 20859453
6-(azepan-1-ylsulfonyl)-N-(3-cyclohexylsulfanylpropyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 20859453) has the molecular formula C28H39N3O4S2 and a molecular weight of 545.77 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-N-(3-cyclohexylsulfanylpropyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | 6-(azepan-1-ylsulfonyl)-N-(3-cyclohexylsulfanylpropyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20859453 |
| Molecular Formula | C28H39N3O4S2 |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-N-(3-cyclohexylsulfanylpropyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)NCCCSC2CCCCC2)c(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc21 |
| InChI | InChI=1S/C28H39N3O4S2/c1-2-16-30-21-25(28(33)29-15-10-19-36-22-11-6-5-7-12-22)27(32)24-20-23(13-14-26(24)30)37(34,35)31-17-8-3-4-9-18-31/h2,13-14,20-22H,1,3-12,15-19H2,(H,29,33) |
| InChIKey | WOVOBZKPGNHVHI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|