C13H10ClN3O2S2 — CID 98465541
(2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-methyl-3-oxopropanamide (PubChem CID 98465541) has the molecular formula C13H10ClN3O2S2 and a molecular weight of 339.83 g/mol. Its IUPAC name is (2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-methyl-3-oxopropanamide.
| Compound Name | (2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 98465541 |
| Molecular Formula | C13H10ClN3O2S2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-methyl-3-oxopropanamide |
| SMILES | CNC(=O)[C@H](C#N)C(=O)c1sc(-c2ccc(Cl)s2)nc1C |
| InChI | InChI=1S/C13H10ClN3O2S2/c1-6-11(10(18)7(5-15)12(19)16-2)21-13(17-6)8-3-4-9(14)20-8/h3-4,7H,1-2H3,(H,16,19)/t7-/m1/s1 |
| InChIKey | RKGDZJRBESKOSF-SSDOTTSWSA-N |
| XLogP | 2.90 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|