C17H16ClN3O2S2 — CID 98475610
(2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-cyclopentyl-3-oxopropanamide (PubChem CID 98475610) has the molecular formula C17H16ClN3O2S2 and a molecular weight of 393.92 g/mol. Its IUPAC name is (2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-cyclopentyl-3-oxopropanamide.
| Compound Name | (2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-cyclopentyl-3-oxopropanamide |
|---|---|
| PubChem CID | 98475610 |
| Molecular Formula | C17H16ClN3O2S2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (2R)-3-[2-(5-chlorothiophen-2-yl)-4-methyl-1,3-thiazol-5-yl]-2-cyano-N-cyclopentyl-3-oxopropanamide |
| SMILES | Cc1nc(-c2ccc(Cl)s2)sc1C(=O)[C@@H](C#N)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H16ClN3O2S2/c1-9-15(25-17(20-9)12-6-7-13(18)24-12)14(22)11(8-19)16(23)21-10-4-2-3-5-10/h6-7,10-11H,2-5H2,1H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | ZNGUVQPWLCXEBG-LLVKDONJSA-N |
| XLogP | 4.21 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|