C19H20N4O2 — CID 98472195
(2R)-2-cyano-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-oxo-N-prop-2-enylpropanamide (PubChem CID 98472195) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (2R)-2-cyano-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-oxo-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-cyano-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-oxo-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 98472195 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2R)-2-cyano-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-oxo-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@H](C#N)C(=O)c1cccc(Cn2nc(C)cc2C)c1 |
| InChI | InChI=1S/C19H20N4O2/c1-4-8-21-19(25)17(11-20)18(24)16-7-5-6-15(10-16)12-23-14(3)9-13(2)22-23/h4-7,9-10,17H,1,8,12H2,2-3H3,(H,21,25)/t17-/m1/s1 |
| InChIKey | FPNMJOHMHMKJCC-QGZVFWFLSA-N |
| XLogP | 2.17 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|