C17H11Cl2N5O2 — CID 98473560
(2S)-2-cyano-N-(2,4-dichlorophenyl)-3-(1-methylbenzotriazol-5-yl)-3-oxopropanamide (PubChem CID 98473560) has the molecular formula C17H11Cl2N5O2 and a molecular weight of 388.21 g/mol. Its IUPAC name is (2S)-2-cyano-N-(2,4-dichlorophenyl)-3-(1-methylbenzotriazol-5-yl)-3-oxopropanamide.
| Compound Name | (2S)-2-cyano-N-(2,4-dichlorophenyl)-3-(1-methylbenzotriazol-5-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 98473560 |
| Molecular Formula | C17H11Cl2N5O2 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | (2S)-2-cyano-N-(2,4-dichlorophenyl)-3-(1-methylbenzotriazol-5-yl)-3-oxopropanamide |
| SMILES | Cn1nnc2cc(C(=O)[C@H](C#N)C(=O)Nc3ccc(Cl)cc3Cl)ccc21 |
| InChI | InChI=1S/C17H11Cl2N5O2/c1-24-15-5-2-9(6-14(15)22-23-24)16(25)11(8-20)17(26)21-13-4-3-10(18)7-12(13)19/h2-7,11H,1H3,(H,21,26)/t11-/m0/s1 |
| InChIKey | KHSHYFOFTBHHGL-NSHDSACASA-N |
| XLogP | 3.24 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|