C20H22N4O — CID 98474952
(Z)-3-(2-methoxyphenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-en-1-amine (PubChem CID 98474952) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is (Z)-3-(2-methoxyphenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-en-1-amine.
| Compound Name | (Z)-3-(2-methoxyphenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 98474952 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (Z)-3-(2-methoxyphenyl)-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]prop-2-en-1-amine |
| SMILES | COc1ccccc1/C=C\CNCc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-25-20-7-3-2-5-19(20)6-4-12-21-13-17-8-10-18(11-9-17)14-24-16-22-15-23-24/h2-11,15-16,21H,12-14H2,1H3/b6-4- |
| InChIKey | KBFOGVRNWQCHCW-XQRVVYSFSA-N |
| XLogP | 3.14 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|