C25H38O7 — CID 98509428
[(1S,2S,5R,6S,9S,10S,11S,12R,14S)-6,12-diacetyloxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadecan-14-yl] acetate (PubChem CID 98509428) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(1S,2S,5R,6S,9S,10S,11S,12R,14S)-6,12-diacetyloxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadecan-14-yl] acetate.
| Compound Name | [(1S,2S,5R,6S,9S,10S,11S,12R,14S)-6,12-diacetyloxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadecan-14-yl] acetate |
|---|---|
| PubChem CID | 98509428 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(1S,2S,5R,6S,9S,10S,11S,12R,14S)-6,12-diacetyloxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadecan-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)O[C@@](OC(C)=O)(C1)[C@@H](C)[C@H]1[C@@H]3CC[C@H](OC(C)=O)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H38O7/c1-14-22-19-7-8-21(30-16(3)27)23(19,5)11-10-20(22)24(6)12-9-18(29-15(2)26)13-25(14,32-24)31-17(4)28/h14,18-22H,7-13H2,1-6H3/t14-,18-,19-,20-,21-,22-,23+,24-,25-/m0/s1 |
| InChIKey | MAIRNOZOLLQOQZ-ZGXQKNMLSA-N |
| XLogP | 4.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|