C35H26N2O5 — CID 98511865
(2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(4-methylbenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 98511865) has the molecular formula C35H26N2O5 and a molecular weight of 554.60 g/mol. Its IUPAC name is (2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(4-methylbenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(4-methylbenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 98511865 |
| Molecular Formula | C35H26N2O5 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(4-methylbenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | Cc1ccc(C(=O)[C@H]2[C@H](C(=O)c3ccc4c(c3)OCO4)N3C=Cc4ccccc4[C@@H]3[C@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C35H26N2O5/c1-20-10-12-22(13-11-20)31(38)29-30(32(39)23-14-15-27-28(18-23)42-19-41-27)37-17-16-21-6-2-3-7-24(21)33(37)35(29)25-8-4-5-9-26(25)36-34(35)40/h2-18,29-30,33H,19H2,1H3,(H,36,40)/t29-,30-,33-,35-/m1/s1 |
| InChIKey | MWZFSCHTCJGNKI-GYEXEWKGSA-N |
| XLogP | 5.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |