C35H26N2O6 — CID 98513217
(2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(3-methoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 98513217) has the molecular formula C35H26N2O6 and a molecular weight of 570.60 g/mol. Its IUPAC name is (2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(3-methoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(3-methoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 98513217 |
| Molecular Formula | C35H26N2O6 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | (2'R,3S,3'R,10'bR)-3'-(1,3-benzodioxole-5-carbonyl)-2'-(3-methoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | COc1cccc(C(=O)[C@H]2[C@H](C(=O)c3ccc4c(c3)OCO4)N3C=Cc4ccccc4[C@@H]3[C@]23C(=O)Nc2ccccc23)c1 |
| InChI | InChI=1S/C35H26N2O6/c1-41-23-9-6-8-21(17-23)31(38)29-30(32(39)22-13-14-27-28(18-22)43-19-42-27)37-16-15-20-7-2-3-10-24(20)33(37)35(29)25-11-4-5-12-26(25)36-34(35)40/h2-18,29-30,33H,19H2,1H3,(H,36,40)/t29-,30-,33-,35-/m1/s1 |
| InChIKey | VHSJHNMGXXIYGX-GYEXEWKGSA-N |
| XLogP | 5.41 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |