C20H23N3O2 — CID 98512279
(E)-N-[(3R)-1-(3-methoxyphenyl)piperidin-3-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 98512279) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-N-[(3R)-1-(3-methoxyphenyl)piperidin-3-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(3R)-1-(3-methoxyphenyl)piperidin-3-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 98512279 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (E)-N-[(3R)-1-(3-methoxyphenyl)piperidin-3-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | COc1cccc(N2CCC[C@@H](NC(=O)/C=C/c3cccnc3)C2)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-25-19-8-2-7-18(13-19)23-12-4-6-17(15-23)22-20(24)10-9-16-5-3-11-21-14-16/h2-3,5,7-11,13-14,17H,4,6,12,15H2,1H3,(H,22,24)/b10-9+/t17-/m1/s1 |
| InChIKey | CLBWLXDEFVJKJY-OAGJVSPASA-N |
| XLogP | 2.89 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|