C30H28F3N5O5S — CID 98527293
(2S)-3-(4-ethoxyphenyl)-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione (PubChem CID 98527293) has the molecular formula C30H28F3N5O5S and a molecular weight of 627.65 g/mol. Its IUPAC name is (2S)-3-(4-ethoxyphenyl)-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione.
| Compound Name | (2S)-3-(4-ethoxyphenyl)-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 98527293 |
| Molecular Formula | C30H28F3N5O5S |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | (2S)-3-(4-ethoxyphenyl)-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
| SMILES | CCOc1ccc(N2C(=O)CS[C@@]23C(=O)N(CN2CCN(c4ccc(C(F)(F)F)cc4[N+](=O)[O-])CC2)c2ccccc23)cc1 |
| InChI | InChI=1S/C30H28F3N5O5S/c1-2-43-22-10-8-21(9-11-22)37-27(39)18-44-29(37)23-5-3-4-6-24(23)36(28(29)40)19-34-13-15-35(16-14-34)25-12-7-20(30(31,32)33)17-26(25)38(41)42/h3-12,17H,2,13-16,18-19H2,1H3/t29-/m0/s1 |
| InChIKey | FZWBLZCVVCRJGB-LJAQVGFWSA-N |
| XLogP | 5.07 |
| TPSA | 99.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|