C24H25F3N4O5 — CID 17380268
4-methyl-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 17380268) has the molecular formula C24H25F3N4O5 and a molecular weight of 506.48 g/mol. Its IUPAC name is 4-methyl-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 4-methyl-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 17380268 |
| Molecular Formula | C24H25F3N4O5 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-methyl-1'-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CC1CCOC2(O1)C(=O)N(CN1CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC1)c1ccccc12 |
| InChI | InChI=1S/C24H25F3N4O5/c1-16-8-13-35-23(36-16)18-4-2-3-5-19(18)30(22(23)32)15-28-9-11-29(12-10-28)20-7-6-17(24(25,26)27)14-21(20)31(33)34/h2-7,14,16H,8-13,15H2,1H3 |
| InChIKey | CSSASOXVCYJHKF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|