C13H13N3O3 — CID 98533741
(1R,2R,6S,9S,10S,11R)-14-methyl-4-oxa-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecane-13,15-dione (PubChem CID 98533741) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is (1R,2R,6S,9S,10S,11R)-14-methyl-4-oxa-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecane-13,15-dione.
| Compound Name | (1R,2R,6S,9S,10S,11R)-14-methyl-4-oxa-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecane-13,15-dione |
|---|---|
| PubChem CID | 98533741 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1R,2R,6S,9S,10S,11R)-14-methyl-4-oxa-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecane-13,15-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1[C@H]3C4C5[C@@]6(COC[C@@]516)[C@H]2[C@@H]43 |
| InChI | InChI=1S/C13H13N3O3/c1-14-10(17)15-8-5-4-6(5)9(16(15)11(14)18)13-3-19-2-12(8,13)7(4)13/h4-9H,2-3H2,1H3/t4?,5-,6-,7?,8+,9+,12-,13+/m0/s1 |
| InChIKey | FWUYOYYYNCHIIG-RAEUIWAVSA-N |
| XLogP | -1.03 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |