C8H14O2S — CID 98538775
(1R,2S,5S,6R)-9-thiabicyclo[3.3.1]nonane-2,6-diol (PubChem CID 98538775) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is (1R,2S,5S,6R)-9-thiabicyclo[3.3.1]nonane-2,6-diol.
| Compound Name | (1R,2S,5S,6R)-9-thiabicyclo[3.3.1]nonane-2,6-diol |
|---|---|
| PubChem CID | 98538775 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (1R,2S,5S,6R)-9-thiabicyclo[3.3.1]nonane-2,6-diol |
| SMILES | O[C@@H]1CC[C@H]2S[C@H]1CC[C@@H]2O |
| InChI | InChI=1S/C8H14O2S/c9-5-1-3-7-6(10)2-4-8(5)11-7/h5-10H,1-4H2/t5-,6+,7-,8+ |
| InChIKey | YWPNTOFLNJJRGE-KVFPUHGPSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |